C25H28ClFN2O2 — CID 45139965
(1S,2R)-1-(3-fluorophenyl)-3-(methylamino)-1-(5-phenylmethoxy-2,3-dihydroindol-1-yl)propan-2-ol;hydrochloride (PubChem CID 45139965) has the molecular formula C25H28ClFN2O2 and a molecular weight of 442.96 g/mol. Its IUPAC name is (1S,2R)-1-(3-fluorophenyl)-3-(methylamino)-1-(5-phenylmethoxy-2,3-dihydroindol-1-yl)propan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-(3-fluorophenyl)-3-(methylamino)-1-(5-phenylmethoxy-2,3-dihydroindol-1-yl)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 45139965 |
| Molecular Formula | C25H28ClFN2O2 |
| Molecular Weight | 442.96 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (1S,2R)-1-(3-fluorophenyl)-3-(methylamino)-1-(5-phenylmethoxy-2,3-dihydroindol-1-yl)propan-2-ol;hydrochloride |
| SMILES | CNC[C@@H](O)[C@H](c1cccc(F)c1)N1CCc2cc(OCc3ccccc3)ccc21.Cl |
| InChI | InChI=1S/C25H27FN2O2.ClH/c1-27-16-24(29)25(20-8-5-9-21(26)14-20)28-13-12-19-15-22(10-11-23(19)28)30-17-18-6-3-2-4-7-18;/h2-11,14-15,24-25,27,29H,12-13,16-17H2,1H3;1H/t24-,25+;/m1./s1 |
| InChIKey | WWIVDDWMWBWRJK-KGQXAQPSSA-N |
| XLogP | 4.51 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.96 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|