C21H42Si — CID 45140052
triethyl-[(1Z,12Z)-pentadeca-1,12-dienyl]silane (PubChem CID 45140052) has the molecular formula C21H42Si and a molecular weight of 322.65 g/mol. Its IUPAC name is triethyl-[(1Z,12Z)-pentadeca-1,12-dienyl]silane.
| Compound Name | triethyl-[(1Z,12Z)-pentadeca-1,12-dienyl]silane |
|---|---|
| PubChem CID | 45140052 |
| Molecular Formula | C21H42Si |
| Molecular Weight | 322.65 g/mol |
| Exact Mass | 322.31 |
| IUPAC Name | triethyl-[(1Z,12Z)-pentadeca-1,12-dienyl]silane |
| SMILES | CC/C=C\CCCCCCCCC/C=C\[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H42Si/c1-5-9-10-11-12-13-14-15-16-17-18-19-20-21-22(6-2,7-3)8-4/h9-10,20-21H,5-8,11-19H2,1-4H3/b10-9-,21-20- |
| InChIKey | NBXXPNPYGUVQMX-SUUOITAFSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.65 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|