C15H20BrN5 — CID 45140078
2-[3-[(1R)-7-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]propyl]guanidine (PubChem CID 45140078) has the molecular formula C15H20BrN5 and a molecular weight of 350.26 g/mol. Its IUPAC name is 2-[3-[(1R)-7-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]propyl]guanidine.
| Compound Name | 2-[3-[(1R)-7-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]propyl]guanidine |
|---|---|
| PubChem CID | 45140078 |
| Molecular Formula | C15H20BrN5 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-[3-[(1R)-7-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]propyl]guanidine |
| SMILES | NC(N)=NCCC[C@H]1NCCc2c1[nH]c1cc(Br)ccc21 |
| InChI | InChI=1S/C15H20BrN5/c16-9-3-4-10-11-5-7-19-12(2-1-6-20-15(17)18)14(11)21-13(10)8-9/h3-4,8,12,19,21H,1-2,5-7H2,(H4,17,18,20)/t12-/m1/s1 |
| InChIKey | FDYSADFFUCUKDQ-GFCCVEGCSA-N |
| XLogP | 2.17 |
| TPSA | 92.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|