About 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one
7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 45140141) has the molecular formula C12H10N4O2
and a molecular weight of 242.24 g/mol. Its IUPAC name is 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| PubChem CID | 45140141 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | Nc1cccc(Oc2ccnc3[nH]c(=O)[nH]c23)c1 |
| InChI | InChI=1S/C12H10N4O2/c13-7-2-1-3-8(6-7)18-9-4-5-14-11-10(9)15-12(17)16-11/h1-6H,13H2,(H2,14,15,16,17) |
| InChIKey | NXAIFDGHBLODCI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one?
The IUPAC name of 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one (CID 45140141) is 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one is Nc1cccc(Oc2ccnc3[nH]c(=O)[nH]c23)c1.
What is the InChIKey of 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one?
The InChIKey is NXAIFDGHBLODCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O2/c13-7-2-1-3-8(6-7)18-9-4-5-14-11-10(9)15-12(17)16-11/h1-6H,13H2,(H2,14,15,16,17).
What are the key properties of 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one?
7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one has a molecular weight of 242.24 g/mol, XLogP of 1.63, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 45140141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).