C12H10N4O2 — CID 45140141
7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 45140141) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one.
| Compound Name | 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 45140141 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 7-(3-aminophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | Nc1cccc(Oc2ccnc3[nH]c(=O)[nH]c23)c1 |
| InChI | InChI=1S/C12H10N4O2/c13-7-2-1-3-8(6-7)18-9-4-5-14-11-10(9)15-12(17)16-11/h1-6H,13H2,(H2,14,15,16,17) |
| InChIKey | NXAIFDGHBLODCI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|