About pentyl piperazine-1-carboxylate
pentyl piperazine-1-carboxylate (PubChem CID 45140356) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is pentyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | pentyl piperazine-1-carboxylate |
| PubChem CID | 45140356 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | pentyl piperazine-1-carboxylate |
| SMILES | CCCCCOC(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H20N2O2/c1-2-3-4-9-14-10(13)12-7-5-11-6-8-12/h11H,2-9H2,1H3 |
| InChIKey | BVLHNYHIALZNRG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl piperazine-1-carboxylate?
The IUPAC name of pentyl piperazine-1-carboxylate (CID 45140356) is pentyl piperazine-1-carboxylate.
What is the SMILES notation for pentyl piperazine-1-carboxylate?
The canonical SMILES for pentyl piperazine-1-carboxylate is CCCCCOC(=O)N1CCNCC1.
What is the InChIKey of pentyl piperazine-1-carboxylate?
The InChIKey is BVLHNYHIALZNRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-2-3-4-9-14-10(13)12-7-5-11-6-8-12/h11H,2-9H2,1H3.
What are the key properties of pentyl piperazine-1-carboxylate?
pentyl piperazine-1-carboxylate has a molecular weight of 200.28 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl piperazine-1-carboxylate is sourced from PubChem (CID 45140356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).