About hexyl piperazine-1-carboxylate
hexyl piperazine-1-carboxylate (PubChem CID 45140358) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is hexyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | hexyl piperazine-1-carboxylate |
| PubChem CID | 45140358 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | hexyl piperazine-1-carboxylate |
| SMILES | CCCCCCOC(=O)N1CCNCC1 |
| InChI | InChI=1S/C11H22N2O2/c1-2-3-4-5-10-15-11(14)13-8-6-12-7-9-13/h12H,2-10H2,1H3 |
| InChIKey | KYPHLXXXYHYDAI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl piperazine-1-carboxylate?
The IUPAC name of hexyl piperazine-1-carboxylate (CID 45140358) is hexyl piperazine-1-carboxylate.
What is the SMILES notation for hexyl piperazine-1-carboxylate?
The canonical SMILES for hexyl piperazine-1-carboxylate is CCCCCCOC(=O)N1CCNCC1.
What is the InChIKey of hexyl piperazine-1-carboxylate?
The InChIKey is KYPHLXXXYHYDAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-2-3-4-5-10-15-11(14)13-8-6-12-7-9-13/h12H,2-10H2,1H3.
What are the key properties of hexyl piperazine-1-carboxylate?
hexyl piperazine-1-carboxylate has a molecular weight of 214.31 g/mol, XLogP of 1.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl piperazine-1-carboxylate is sourced from PubChem (CID 45140358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).