About (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol
(4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol (PubChem CID 45140400) has the molecular formula C14H12BrF3OS
and a molecular weight of 365.21 g/mol. Its IUPAC name is (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol.
Molecular Properties
| Compound Name | (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol |
| PubChem CID | 45140400 |
| Molecular Formula | C14H12BrF3OS |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol |
| SMILES | Cc1sc(C)c(C(O)c2ccc(C(F)(F)F)cc2)c1Br |
| InChI | InChI=1S/C14H12BrF3OS/c1-7-11(12(15)8(2)20-7)13(19)9-3-5-10(6-4-9)14(16,17)18/h3-6,13,19H,1-2H3 |
| InChIKey | DVKGGEXFKYWSOO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol?
The IUPAC name of (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol (CID 45140400) is (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol.
What is the SMILES notation for (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol?
The canonical SMILES for (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol is Cc1sc(C)c(C(O)c2ccc(C(F)(F)F)cc2)c1Br.
What is the InChIKey of (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol?
The InChIKey is DVKGGEXFKYWSOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrF3OS/c1-7-11(12(15)8(2)20-7)13(19)9-3-5-10(6-4-9)14(16,17)18/h3-6,13,19H,1-2H3.
What are the key properties of (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol?
(4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol has a molecular weight of 365.21 g/mol, XLogP of 5.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2,5-dimethylthiophen-3-yl)-[4-(trifluoromethyl)phenyl]methanol is sourced from PubChem (CID 45140400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).