About (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate
(4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate (PubChem CID 45140412) has the molecular formula C22H18F3N3O3
and a molecular weight of 429.40 g/mol. Its IUPAC name is (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate.
Molecular Properties
| Compound Name | (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate |
| PubChem CID | 45140412 |
| Molecular Formula | C22H18F3N3O3 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2cc(C)ccc2Nc2ccnc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H18F3N3O3/c1-13-3-8-19(28-16-9-10-26-20(12-16)22(23,24)25)18(11-13)21(30)31-17-6-4-15(5-7-17)27-14(2)29/h3-12H,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | DETOZEPLBMGISC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
The IUPAC name of (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate (CID 45140412) is (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate.
What is the SMILES notation for (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
The canonical SMILES for (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate is CC(=O)Nc1ccc(OC(=O)c2cc(C)ccc2Nc2ccnc(C(F)(F)F)c2)cc1.
What is the InChIKey of (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
The InChIKey is DETOZEPLBMGISC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F3N3O3/c1-13-3-8-19(28-16-9-10-26-20(12-16)22(23,24)25)18(11-13)21(30)31-17-6-4-15(5-7-17)27-14(2)29/h3-12H,1-2H3,(H,26,28)(H,27,29).
What are the key properties of (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
(4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate has a molecular weight of 429.40 g/mol, XLogP of 5.33, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) 5-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate is sourced from PubChem (CID 45140412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).