C11H18O5 — CID 45140480
methyl (3aS,4R,7aR)-4-hydroxy-2,2-dimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzodioxole-3a-carboxylate (PubChem CID 45140480) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl (3aS,4R,7aR)-4-hydroxy-2,2-dimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzodioxole-3a-carboxylate.
| Compound Name | methyl (3aS,4R,7aR)-4-hydroxy-2,2-dimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzodioxole-3a-carboxylate |
|---|---|
| PubChem CID | 45140480 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | methyl (3aS,4R,7aR)-4-hydroxy-2,2-dimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzodioxole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12OC(C)(C)O[C@@H]1CCC[C@H]2O |
| InChI | InChI=1S/C11H18O5/c1-10(2)15-8-6-4-5-7(12)11(8,16-10)9(13)14-3/h7-8,12H,4-6H2,1-3H3/t7-,8-,11+/m1/s1 |
| InChIKey | SAKPAXMSIDHCAN-XLDPMVHQSA-N |
| XLogP | 0.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |