C14H13F3N2O3 — CID 45140501
(4R,5R)-5-nitro-1-prop-2-enyl-4-(2,4,5-trifluorophenyl)piperidin-2-one (PubChem CID 45140501) has the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. Its IUPAC name is (4R,5R)-5-nitro-1-prop-2-enyl-4-(2,4,5-trifluorophenyl)piperidin-2-one.
| Compound Name | (4R,5R)-5-nitro-1-prop-2-enyl-4-(2,4,5-trifluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 45140501 |
| Molecular Formula | C14H13F3N2O3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (4R,5R)-5-nitro-1-prop-2-enyl-4-(2,4,5-trifluorophenyl)piperidin-2-one |
| SMILES | C=CCN1C[C@H]([N+](=O)[O-])[C@@H](c2cc(F)c(F)cc2F)CC1=O |
| InChI | InChI=1S/C14H13F3N2O3/c1-2-3-18-7-13(19(21)22)9(5-14(18)20)8-4-11(16)12(17)6-10(8)15/h2,4,6,9,13H,1,3,5,7H2/t9-,13+/m1/s1 |
| InChIKey | QPWVNNPAGSECEI-RNCFNFMXSA-N |
| XLogP | 2.25 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|