C12H3Br2F5S — CID 45140625
2,5-dibromo-3-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]thiophene (PubChem CID 45140625) has the molecular formula C12H3Br2F5S and a molecular weight of 434.02 g/mol. Its IUPAC name is 2,5-dibromo-3-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]thiophene.
| Compound Name | 2,5-dibromo-3-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]thiophene |
|---|---|
| PubChem CID | 45140625 |
| Molecular Formula | C12H3Br2F5S |
| Molecular Weight | 434.02 g/mol |
| Exact Mass | 431.82 |
| IUPAC Name | 2,5-dibromo-3-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]thiophene |
| SMILES | Fc1c(F)c(F)c(/C=C/c2cc(Br)sc2Br)c(F)c1F |
| InChI | InChI=1S/C12H3Br2F5S/c13-6-3-4(12(14)20-6)1-2-5-7(15)9(17)11(19)10(18)8(5)16/h1-3H/b2-1+ |
| InChIKey | VYFTWARFCVXWLB-OWOJBTEDSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.02 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|