C16H19F3N2O3 — CID 45140694
tert-butyl N-[(3R,4R)-6-oxo-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate (PubChem CID 45140694) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-6-oxo-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-6-oxo-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 45140694 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | tert-butyl N-[(3R,4R)-6-oxo-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNC(=O)C[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H19F3N2O3/c1-16(2,3)24-15(23)21-13-7-20-14(22)5-9(13)8-4-11(18)12(19)6-10(8)17/h4,6,9,13H,5,7H2,1-3H3,(H,20,22)(H,21,23)/t9-,13+/m1/s1 |
| InChIKey | XVLZNAHLOCVRAW-RNCFNFMXSA-N |
| XLogP | 2.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|