C24H24O2S — CID 45141651
(1R,6S,12S)-7-[(S)-(4-methylphenyl)sulfinyl]-6-phenyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-diene (PubChem CID 45141651) has the molecular formula C24H24O2S and a molecular weight of 376.52 g/mol. Its IUPAC name is (1R,6S,12S)-7-[(S)-(4-methylphenyl)sulfinyl]-6-phenyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-diene.
| Compound Name | (1R,6S,12S)-7-[(S)-(4-methylphenyl)sulfinyl]-6-phenyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-diene |
|---|---|
| PubChem CID | 45141651 |
| Molecular Formula | C24H24O2S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (1R,6S,12S)-7-[(S)-(4-methylphenyl)sulfinyl]-6-phenyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-diene |
| SMILES | Cc1ccc([S@](=O)C2=C3CCC[C@H]4OCC(=C[C@H]2c2ccccc2)[C@@H]34)cc1 |
| InChI | InChI=1S/C24H24O2S/c1-16-10-12-19(13-11-16)27(25)24-20-8-5-9-22-23(20)18(15-26-22)14-21(24)17-6-3-2-4-7-17/h2-4,6-7,10-14,21-23H,5,8-9,15H2,1H3/t21-,22+,23-,27-/m0/s1 |
| InChIKey | XOAHNOWLIVFPCG-GIRPNKPCSA-N |
| XLogP | 5.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|