C32H44N6O6 — CID 45141770
(4S)-4-[[4-(4-aminopiperidin-1-yl)-6-phenylpyridine-2-carbonyl]amino]-5-oxo-5-(4-pentoxycarbonylpiperazin-1-yl)pentanoic acid (PubChem CID 45141770) has the molecular formula C32H44N6O6 and a molecular weight of 608.74 g/mol. Its IUPAC name is (4S)-4-[[4-(4-aminopiperidin-1-yl)-6-phenylpyridine-2-carbonyl]amino]-5-oxo-5-(4-pentoxycarbonylpiperazin-1-yl)pentanoic acid.
| Compound Name | (4S)-4-[[4-(4-aminopiperidin-1-yl)-6-phenylpyridine-2-carbonyl]amino]-5-oxo-5-(4-pentoxycarbonylpiperazin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 45141770 |
| Molecular Formula | C32H44N6O6 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | (4S)-4-[[4-(4-aminopiperidin-1-yl)-6-phenylpyridine-2-carbonyl]amino]-5-oxo-5-(4-pentoxycarbonylpiperazin-1-yl)pentanoic acid |
| SMILES | CCCCCOC(=O)N1CCN(C(=O)[C@H](CCC(=O)O)NC(=O)c2cc(N3CCC(N)CC3)cc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C32H44N6O6/c1-2-3-7-20-44-32(43)38-18-16-37(17-19-38)31(42)26(10-11-29(39)40)35-30(41)28-22-25(36-14-12-24(33)13-15-36)21-27(34-28)23-8-5-4-6-9-23/h4-6,8-9,21-22,24,26H,2-3,7,10-20,33H2,1H3,(H,35,41)(H,39,40)/t26-/m0/s1 |
| InChIKey | SFHLUEHLUTYHKL-SANMLTNESA-N |
| XLogP | 3.11 |
| TPSA | 158.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|