About ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate
ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate (PubChem CID 45141798) has the molecular formula C14H13F3N4O5S
and a molecular weight of 406.34 g/mol. Its IUPAC name is ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate |
| PubChem CID | 45141798 |
| Molecular Formula | C14H13F3N4O5S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate |
| SMILES | CCOC(=O)c1nn(C)c2c1CCc1cnc(OS(=O)(=O)C(F)(F)F)nc1-2 |
| InChI | InChI=1S/C14H13F3N4O5S/c1-3-25-12(22)10-8-5-4-7-6-18-13(26-27(23,24)14(15,16)17)19-9(7)11(8)21(2)20-10/h6H,3-5H2,1-2H3 |
| InChIKey | MHRYZTTWUDFNBM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 113.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate?
The IUPAC name of ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate (CID 45141798) is ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate.
What is the SMILES notation for ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate?
The canonical SMILES for ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate is CCOC(=O)c1nn(C)c2c1CCc1cnc(OS(=O)(=O)C(F)(F)F)nc1-2.
What is the InChIKey of ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate?
The InChIKey is MHRYZTTWUDFNBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N4O5S/c1-3-25-12(22)10-8-5-4-7-6-18-13(26-27(23,24)14(15,16)17)19-9(7)11(8)21(2)20-10/h6H,3-5H2,1-2H3.
What are the key properties of ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate?
ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate has a molecular weight of 406.34 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-methyl-8-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate is sourced from PubChem (CID 45141798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).