C28H30N4O5 — CID 45141869
N,N-dimethyl-4-[1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4,5-dioxo-2-pentan-3-ylpyrrolidine-3-carbonyl]benzamide (PubChem CID 45141869) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4,5-dioxo-2-pentan-3-ylpyrrolidine-3-carbonyl]benzamide.
| Compound Name | N,N-dimethyl-4-[1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4,5-dioxo-2-pentan-3-ylpyrrolidine-3-carbonyl]benzamide |
|---|---|
| PubChem CID | 45141869 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | N,N-dimethyl-4-[1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4,5-dioxo-2-pentan-3-ylpyrrolidine-3-carbonyl]benzamide |
| SMILES | CCC(CC)C1C(C(=O)c2ccc(C(=O)N(C)C)cc2)C(=O)C(=O)N1c1ccc(-c2noc(C)n2)cc1 |
| InChI | InChI=1S/C28H30N4O5/c1-6-17(7-2)23-22(24(33)18-8-10-20(11-9-18)27(35)31(4)5)25(34)28(36)32(23)21-14-12-19(13-15-21)26-29-16(3)37-30-26/h8-15,17,22-23H,6-7H2,1-5H3 |
| InChIKey | NFBAEMGMHRZVNJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 113.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|