C19H16O3 — CID 45142039
14-methyl-6-propyl-12,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),13-heptaen-16-one (PubChem CID 45142039) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is 14-methyl-6-propyl-12,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),13-heptaen-16-one.
| Compound Name | 14-methyl-6-propyl-12,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),13-heptaen-16-one |
|---|---|
| PubChem CID | 45142039 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 14-methyl-6-propyl-12,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),13-heptaen-16-one |
| SMILES | CCCc1cccc2c1ccc1c3occ(C)c3c(=O)oc21 |
| InChI | InChI=1S/C19H16O3/c1-3-5-12-6-4-7-14-13(12)8-9-15-17(14)22-19(20)16-11(2)10-21-18(15)16/h4,6-10H,3,5H2,1-2H3 |
| InChIKey | IVVFSFQMGXHHGW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|