C17H29NO3SSi — CID 45142384
N-[1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-4-methylbenzenesulfonamide (PubChem CID 45142384) has the molecular formula C17H29NO3SSi and a molecular weight of 355.58 g/mol. Its IUPAC name is N-[1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 45142384 |
| Molecular Formula | C17H29NO3SSi |
| Molecular Weight | 355.58 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-4-methylbenzenesulfonamide |
| SMILES | C=CC(CO[Si](C)(C)C(C)(C)C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H29NO3SSi/c1-8-15(13-21-23(6,7)17(3,4)5)18-22(19,20)16-11-9-14(2)10-12-16/h8-12,15,18H,1,13H2,2-7H3 |
| InChIKey | ODWVXAQCRXKFGV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|