C19H20N4O3 — CID 45142563
5-[(2E)-2-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]hydrazinyl]-2-prop-1-en-2-yl-1,3-oxazole-4-carbonitrile (PubChem CID 45142563) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 5-[(2E)-2-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]hydrazinyl]-2-prop-1-en-2-yl-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[(2E)-2-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]hydrazinyl]-2-prop-1-en-2-yl-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 45142563 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 5-[(2E)-2-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]hydrazinyl]-2-prop-1-en-2-yl-1,3-oxazole-4-carbonitrile |
| SMILES | C=CCOc1ccc(/C=N/Nc2oc(C(=C)C)nc2C#N)cc1OCC |
| InChI | InChI=1S/C19H20N4O3/c1-5-9-25-16-8-7-14(10-17(16)24-6-2)12-21-23-19-15(11-20)22-18(26-19)13(3)4/h5,7-8,10,12,23H,1,3,6,9H2,2,4H3/b21-12+ |
| InChIKey | CQSHOCLSAVNLDH-CIAFOILYSA-N |
| XLogP | 3.99 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|