About N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine
N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine (PubChem CID 45143052) has the molecular formula C21H23N3OS
and a molecular weight of 365.50 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine |
| PubChem CID | 45143052 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine |
| SMILES | Cc1cccc(C)c1/N=c1\scc(-c2ccccc2)n1N1CCOCC1 |
| InChI | InChI=1S/C21H23N3OS/c1-16-7-6-8-17(2)20(16)22-21-24(23-11-13-25-14-12-23)19(15-26-21)18-9-4-3-5-10-18/h3-10,15H,11-14H2,1-2H3/b22-21- |
| InChIKey | KXXMIDRWVMLDSR-DQRAZIAOSA-N |
| XLogP | 4.03 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine?
The IUPAC name of N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine (CID 45143052) is N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine.
What is the SMILES notation for N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine?
The canonical SMILES for N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine is Cc1cccc(C)c1/N=c1\scc(-c2ccccc2)n1N1CCOCC1.
What is the InChIKey of N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine?
The InChIKey is KXXMIDRWVMLDSR-DQRAZIAOSA-N. The full InChI is InChI=1S/C21H23N3OS/c1-16-7-6-8-17(2)20(16)22-21-24(23-11-13-25-14-12-23)19(15-26-21)18-9-4-3-5-10-18/h3-10,15H,11-14H2,1-2H3/b22-21-.
What are the key properties of N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine?
N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine has a molecular weight of 365.50 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylphenyl)-3-morpholin-4-yl-4-phenyl-1,3-thiazol-2-imine is sourced from PubChem (CID 45143052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).