C23H36N2O4 — CID 45143531
2-[4-(2-methoxyphenyl)-2,2-dimethyloxan-4-yl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 45143531) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)-2,2-dimethyloxan-4-yl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[4-(2-methoxyphenyl)-2,2-dimethyloxan-4-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 45143531 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)-2,2-dimethyloxan-4-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | COc1ccccc1C1(CC(=O)NCCCN2CCOCC2)CCOC(C)(C)C1 |
| InChI | InChI=1S/C23H36N2O4/c1-22(2)18-23(9-14-29-22,19-7-4-5-8-20(19)27-3)17-21(26)24-10-6-11-25-12-15-28-16-13-25/h4-5,7-8H,6,9-18H2,1-3H3,(H,24,26) |
| InChIKey | GPPHRBFQHOGYAG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|