C23H22N2O2 — CID 45144782
3-[2-[(4-phenylphenyl)methyl]benzimidazol-1-yl]propane-1,2-diol (PubChem CID 45144782) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-[2-[(4-phenylphenyl)methyl]benzimidazol-1-yl]propane-1,2-diol.
| Compound Name | 3-[2-[(4-phenylphenyl)methyl]benzimidazol-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 45144782 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3-[2-[(4-phenylphenyl)methyl]benzimidazol-1-yl]propane-1,2-diol |
| SMILES | OCC(O)Cn1c(Cc2ccc(-c3ccccc3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C23H22N2O2/c26-16-20(27)15-25-22-9-5-4-8-21(22)24-23(25)14-17-10-12-19(13-11-17)18-6-2-1-3-7-18/h1-13,20,26-27H,14-16H2 |
| InChIKey | SZSKKHGGIBJGDV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |