C18H16BrClN2S — CID 45145335
5-(4-chlorophenyl)-7-(4-methylphenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide (PubChem CID 45145335) has the molecular formula C18H16BrClN2S and a molecular weight of 407.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-7-(4-methylphenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide.
| Compound Name | 5-(4-chlorophenyl)-7-(4-methylphenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide |
|---|---|
| PubChem CID | 45145335 |
| Molecular Formula | C18H16BrClN2S |
| Molecular Weight | 407.76 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 5-(4-chlorophenyl)-7-(4-methylphenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide |
| SMILES | Cc1ccc(-n2cc(-c3ccc(Cl)cc3)[n+]3c2SCC3)cc1.[Br-] |
| InChI | InChI=1S/C18H16ClN2S.BrH/c1-13-2-8-16(9-3-13)21-12-17(20-10-11-22-18(20)21)14-4-6-15(19)7-5-14;/h2-9,12H,10-11H2,1H3;1H/q+1;/p-1 |
| InChIKey | DTYISDCSPBPKQR-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.76 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|