C17H18BrNO4S — CID 45146130
1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-2-methyl-2,3-dihydroindole (PubChem CID 45146130) has the molecular formula C17H18BrNO4S and a molecular weight of 412.31 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-2-methyl-2,3-dihydroindole.
| Compound Name | 1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 45146130 |
| Molecular Formula | C17H18BrNO4S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-2-methyl-2,3-dihydroindole |
| SMILES | COc1cc(S(=O)(=O)N2c3ccccc3CC2C)c(OC)cc1Br |
| InChI | InChI=1S/C17H18BrNO4S/c1-11-8-12-6-4-5-7-14(12)19(11)24(20,21)17-10-15(22-2)13(18)9-16(17)23-3/h4-7,9-11H,8H2,1-3H3 |
| InChIKey | RBNRNHMOUYEWEF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |