C18H15BrN2O3 — CID 45146908
(2Z)-6-bromo-N-(2,3-dimethylphenyl)-2-hydroxyiminochromene-3-carboxamide (PubChem CID 45146908) has the molecular formula C18H15BrN2O3 and a molecular weight of 387.23 g/mol. Its IUPAC name is (2Z)-6-bromo-N-(2,3-dimethylphenyl)-2-hydroxyiminochromene-3-carboxamide.
| Compound Name | (2Z)-6-bromo-N-(2,3-dimethylphenyl)-2-hydroxyiminochromene-3-carboxamide |
|---|---|
| PubChem CID | 45146908 |
| Molecular Formula | C18H15BrN2O3 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | (2Z)-6-bromo-N-(2,3-dimethylphenyl)-2-hydroxyiminochromene-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc3cc(Br)ccc3o/c2=N\O)c1C |
| InChI | InChI=1S/C18H15BrN2O3/c1-10-4-3-5-15(11(10)2)20-17(22)14-9-12-8-13(19)6-7-16(12)24-18(14)21-23/h3-9,23H,1-2H3,(H,20,22)/b21-18- |
| InChIKey | PJKMNOZJKZWBQL-UZYVYHOESA-N |
| XLogP | 4.35 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|