C25H22N4O2 — CID 45147088
2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-pyridin-2-ylacetamide (PubChem CID 45147088) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-pyridin-2-ylacetamide.
| Compound Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 45147088 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-pyridin-2-ylacetamide |
| SMILES | Cc1c(C2c3ccccc3C(=O)N2CC(=O)Nc2ccccn2)c2ccccc2n1C |
| InChI | InChI=1S/C25H22N4O2/c1-16-23(19-11-5-6-12-20(19)28(16)2)24-17-9-3-4-10-18(17)25(31)29(24)15-22(30)27-21-13-7-8-14-26-21/h3-14,24H,15H2,1-2H3,(H,26,27,30) |
| InChIKey | URGVKHLLRJYJIF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|