C12H21N3O — CID 45147216
3,3-dimethyl-N-[1-(1-methylpyrazol-4-yl)ethyl]butanamide (PubChem CID 45147216) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 3,3-dimethyl-N-[1-(1-methylpyrazol-4-yl)ethyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[1-(1-methylpyrazol-4-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 45147216 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3,3-dimethyl-N-[1-(1-methylpyrazol-4-yl)ethyl]butanamide |
| SMILES | CC(NC(=O)CC(C)(C)C)c1cnn(C)c1 |
| InChI | InChI=1S/C12H21N3O/c1-9(10-7-13-15(5)8-10)14-11(16)6-12(2,3)4/h7-9H,6H2,1-5H3,(H,14,16) |
| InChIKey | AEXDJYZSZKSYNW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |