C18H17N5O4 — CID 45148199
4-[[2-[4-(tetrazol-1-yl)phenoxy]propanoylamino]methyl]benzoic acid (PubChem CID 45148199) has the molecular formula C18H17N5O4 and a molecular weight of 367.37 g/mol. Its IUPAC name is 4-[[2-[4-(tetrazol-1-yl)phenoxy]propanoylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-[4-(tetrazol-1-yl)phenoxy]propanoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 45148199 |
| Molecular Formula | C18H17N5O4 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 4-[[2-[4-(tetrazol-1-yl)phenoxy]propanoylamino]methyl]benzoic acid |
| SMILES | CC(Oc1ccc(-n2cnnn2)cc1)C(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H17N5O4/c1-12(17(24)19-10-13-2-4-14(5-3-13)18(25)26)27-16-8-6-15(7-9-16)23-11-20-21-22-23/h2-9,11-12H,10H2,1H3,(H,19,24)(H,25,26) |
| InChIKey | ULNWUGIXJCBREJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |