C20H22N4O5S3 — CID 45148451
1-(1,1-dioxothiolan-3-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 45148451) has the molecular formula C20H22N4O5S3 and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 45148451 |
| Molecular Formula | C20H22N4O5S3 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)c3nn(C4CCS(=O)(=O)C4)c4c3CCCC4)sc2c1 |
| InChI | InChI=1S/C20H22N4O5S3/c1-31(26,27)13-6-7-15-17(10-13)30-20(21-15)22-19(25)18-14-4-2-3-5-16(14)24(23-18)12-8-9-32(28,29)11-12/h6-7,10,12H,2-5,8-9,11H2,1H3,(H,21,22,25) |
| InChIKey | OJTMJQKZRQTANL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |