C29H26ClNO5 — CID 45148665
[4-[(1,3-diphenyl-6,7-dihydrocyclopenta[c]pyran-5-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate (PubChem CID 45148665) has the molecular formula C29H26ClNO5 and a molecular weight of 503.98 g/mol. Its IUPAC name is [4-[(1,3-diphenyl-6,7-dihydrocyclopenta[c]pyran-5-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate.
| Compound Name | [4-[(1,3-diphenyl-6,7-dihydrocyclopenta[c]pyran-5-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 45148665 |
| Molecular Formula | C29H26ClNO5 |
| Molecular Weight | 503.98 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | [4-[(1,3-diphenyl-6,7-dihydrocyclopenta[c]pyran-5-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
| SMILES | C[N+](C)=C1C=CC(=CC2=C3C=C(c4ccccc4)OC(c4ccccc4)=C3CC2)C=C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H26NO.ClHO4/c1-30(2)25-16-13-21(14-17-25)19-24-15-18-26-27(24)20-28(22-9-5-3-6-10-22)31-29(26)23-11-7-4-8-12-23;2-1(3,4)5/h3-14,16-17,19-20H,15,18H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HMXWZGPHALQJNM-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 104.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.98 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|