C27H23ClN4O2S2 — CID 45155439
5-(4-chlorophenyl)sulfanyl-N'-(4-methylbenzoyl)-2-[(3-methylphenyl)methylsulfanyl]pyrimidine-4-carbohydrazide (PubChem CID 45155439) has the molecular formula C27H23ClN4O2S2 and a molecular weight of 535.09 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfanyl-N'-(4-methylbenzoyl)-2-[(3-methylphenyl)methylsulfanyl]pyrimidine-4-carbohydrazide.
| Compound Name | 5-(4-chlorophenyl)sulfanyl-N'-(4-methylbenzoyl)-2-[(3-methylphenyl)methylsulfanyl]pyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 45155439 |
| Molecular Formula | C27H23ClN4O2S2 |
| Molecular Weight | 535.09 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 5-(4-chlorophenyl)sulfanyl-N'-(4-methylbenzoyl)-2-[(3-methylphenyl)methylsulfanyl]pyrimidine-4-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2nc(SCc3cccc(C)c3)ncc2Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H23ClN4O2S2/c1-17-6-8-20(9-7-17)25(33)31-32-26(34)24-23(36-22-12-10-21(28)11-13-22)15-29-27(30-24)35-16-19-5-3-4-18(2)14-19/h3-15H,16H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | WPDULYWOQJVYIF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.09 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|