C25H21BrN2O2S — CID 45155574
(14Z)-14-[(5-bromo-2-hydroxyphenyl)methylidene]-3-thia-1,12-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),15,17,19-pentaen-11-one (PubChem CID 45155574) has the molecular formula C25H21BrN2O2S and a molecular weight of 493.43 g/mol. Its IUPAC name is (14Z)-14-[(5-bromo-2-hydroxyphenyl)methylidene]-3-thia-1,12-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),15,17,19-pentaen-11-one.
| Compound Name | (14Z)-14-[(5-bromo-2-hydroxyphenyl)methylidene]-3-thia-1,12-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),15,17,19-pentaen-11-one |
|---|---|
| PubChem CID | 45155574 |
| Molecular Formula | C25H21BrN2O2S |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | (14Z)-14-[(5-bromo-2-hydroxyphenyl)methylidene]-3-thia-1,12-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),15,17,19-pentaen-11-one |
| SMILES | O=C1NC2/C(=C\c3cc(Br)ccc3O)c3ccccc3CN2c2sc3c(c21)CCCC3 |
| InChI | InChI=1S/C25H21BrN2O2S/c26-16-9-10-20(29)15(11-16)12-19-17-6-2-1-5-14(17)13-28-23(19)27-24(30)22-18-7-3-4-8-21(18)31-25(22)28/h1-2,5-6,9-12,23,29H,3-4,7-8,13H2,(H,27,30)/b19-12- |
| InChIKey | DDNUSOJLYDLBCF-UNOMPAQXSA-N |
| XLogP | 5.73 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|