About (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide
(E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide (PubChem CID 45156170) has the molecular formula C16H12BrClFN3S
and a molecular weight of 412.72 g/mol. Its IUPAC name is (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide.
Molecular Properties
| Compound Name | (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide |
| PubChem CID | 45156170 |
| Molecular Formula | C16H12BrClFN3S |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide |
| SMILES | Br.Fc1ccc(/C=N/C2=NNC(c3ccc(Cl)cc3)=CS2)cc1 |
| InChI | InChI=1S/C16H11ClFN3S.BrH/c17-13-5-3-12(4-6-13)15-10-22-16(21-20-15)19-9-11-1-7-14(18)8-2-11;/h1-10,20H;1H/b19-9+; |
| InChIKey | AFOAJYVSNRKEHC-MYHMWQFYSA-N |
| XLogP | 5.08 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide?
The IUPAC name of (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide (CID 45156170) is (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide.
What is the SMILES notation for (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide?
The canonical SMILES for (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide is Br.Fc1ccc(/C=N/C2=NNC(c3ccc(Cl)cc3)=CS2)cc1.
What is the InChIKey of (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide?
The InChIKey is AFOAJYVSNRKEHC-MYHMWQFYSA-N. The full InChI is InChI=1S/C16H11ClFN3S.BrH/c17-13-5-3-12(4-6-13)15-10-22-16(21-20-15)19-9-11-1-7-14(18)8-2-11;/h1-10,20H;1H/b19-9+;.
What are the key properties of (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide?
(E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide has a molecular weight of 412.72 g/mol, XLogP of 5.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[5-(4-chlorophenyl)-4H-1,3,4-thiadiazin-2-yl]-1-(4-fluorophenyl)methanimine;hydrobromide is sourced from PubChem (CID 45156170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).