About 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene
5-(4-fluorophenyl)-1,2,3-trimethoxybenzene (PubChem CID 45156545) has the molecular formula C15H15FO3
and a molecular weight of 262.28 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene |
| PubChem CID | 45156545 |
| Molecular Formula | C15H15FO3 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(-c2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C15H15FO3/c1-17-13-8-11(9-14(18-2)15(13)19-3)10-4-6-12(16)7-5-10/h4-9H,1-3H3 |
| InChIKey | VFRUQUMDJIEBKK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene?
The IUPAC name of 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene (CID 45156545) is 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene.
What is the SMILES notation for 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene?
The canonical SMILES for 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene is COc1cc(-c2ccc(F)cc2)cc(OC)c1OC.
What is the InChIKey of 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene?
The InChIKey is VFRUQUMDJIEBKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FO3/c1-17-13-8-11(9-14(18-2)15(13)19-3)10-4-6-12(16)7-5-10/h4-9H,1-3H3.
What are the key properties of 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene?
5-(4-fluorophenyl)-1,2,3-trimethoxybenzene has a molecular weight of 262.28 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-1,2,3-trimethoxybenzene is sourced from PubChem (CID 45156545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).