About 2-(3,5-dimethyl-1-adamantyl)acetohydrazide
2-(3,5-dimethyl-1-adamantyl)acetohydrazide (PubChem CID 45156686) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)acetohydrazide.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)acetohydrazide |
| PubChem CID | 45156686 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)acetohydrazide |
| SMILES | CC12CC3CC(C)(C1)CC(CC(=O)NN)(C3)C2 |
| InChI | InChI=1S/C14H24N2O/c1-12-3-10-4-13(2,7-12)9-14(5-10,8-12)6-11(17)16-15/h10H,3-9,15H2,1-2H3,(H,16,17) |
| InChIKey | QSGUTXXGKBGRPA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethyl-1-adamantyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1-adamantyl)acetohydrazide?
The IUPAC name of 2-(3,5-dimethyl-1-adamantyl)acetohydrazide (CID 45156686) is 2-(3,5-dimethyl-1-adamantyl)acetohydrazide.
What is the SMILES notation for 2-(3,5-dimethyl-1-adamantyl)acetohydrazide?
The canonical SMILES for 2-(3,5-dimethyl-1-adamantyl)acetohydrazide is CC12CC3CC(C)(C1)CC(CC(=O)NN)(C3)C2.
What is the InChIKey of 2-(3,5-dimethyl-1-adamantyl)acetohydrazide?
The InChIKey is QSGUTXXGKBGRPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O/c1-12-3-10-4-13(2,7-12)9-14(5-10,8-12)6-11(17)16-15/h10H,3-9,15H2,1-2H3,(H,16,17).
What are the key properties of 2-(3,5-dimethyl-1-adamantyl)acetohydrazide?
2-(3,5-dimethyl-1-adamantyl)acetohydrazide has a molecular weight of 236.36 g/mol, XLogP of 2.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1-adamantyl)acetohydrazide is sourced from PubChem (CID 45156686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).