About CID 45157476
CID 45157476 (PubChem CID 45157476) has the molecular formula C7H7NNaO4S
and a molecular weight of 224.19 g/mol.
Molecular Properties
| Compound Name | CID 45157476 |
| PubChem CID | 45157476 |
| Molecular Formula | C7H7NNaO4S |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | — |
| SMILES | O.O=C1NS(=O)(=O)c2ccccc21.[Na] |
| InChI | InChI=1S/C7H5NO3S.Na.H2O/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;;/h1-4H,(H,8,9);;1H2 |
| InChIKey | ADGODYTXWSFUEZ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 45157476 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 45157476?
The IUPAC name of CID 45157476 (CID 45157476) is not available.
What is the SMILES notation for CID 45157476?
The canonical SMILES for CID 45157476 is O.O=C1NS(=O)(=O)c2ccccc21.[Na].
What is the InChIKey of CID 45157476?
The InChIKey is ADGODYTXWSFUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S.Na.H2O/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;;/h1-4H,(H,8,9);;1H2.
What are the key properties of CID 45157476?
CID 45157476 has a molecular weight of 224.19 g/mol, XLogP of -1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 45157476 is sourced from PubChem (CID 45157476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).