About [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate
[(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate (PubChem CID 45157779) has the molecular formula C16H12F2N4O2
and a molecular weight of 330.29 g/mol. Its IUPAC name is [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate.
Molecular Properties
| Compound Name | [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate |
| PubChem CID | 45157779 |
| Molecular Formula | C16H12F2N4O2 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate |
| SMILES | C/C(Cn1nnc2ccccc21)=N\OC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H12F2N4O2/c1-10(9-22-14-8-3-2-7-13(14)19-21-22)20-24-16(23)15-11(17)5-4-6-12(15)18/h2-8H,9H2,1H3/b20-10+ |
| InChIKey | VDVNXPKDYQKURS-KEBDBYFISA-N |
| XLogP | 2.94 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate?
The IUPAC name of [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate (CID 45157779) is [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate.
What is the SMILES notation for [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate?
The canonical SMILES for [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate is C/C(Cn1nnc2ccccc21)=N\OC(=O)c1c(F)cccc1F.
What is the InChIKey of [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate?
The InChIKey is VDVNXPKDYQKURS-KEBDBYFISA-N. The full InChI is InChI=1S/C16H12F2N4O2/c1-10(9-22-14-8-3-2-7-13(14)19-21-22)20-24-16(23)15-11(17)5-4-6-12(15)18/h2-8H,9H2,1H3/b20-10+.
What are the key properties of [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate?
[(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate has a molecular weight of 330.29 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(benzotriazol-1-yl)propan-2-ylideneamino] 2,6-difluorobenzoate is sourced from PubChem (CID 45157779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).