About ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide
ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide (PubChem CID 45157809) has the molecular formula C10H21IN2S
and a molecular weight of 328.26 g/mol. Its IUPAC name is ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide.
Molecular Properties
| Compound Name | ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide |
| PubChem CID | 45157809 |
| Molecular Formula | C10H21IN2S |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide |
| SMILES | CCC/N=C(\SCC)N1CCCC1.I |
| InChI | InChI=1S/C10H20N2S.HI/c1-3-7-11-10(13-4-2)12-8-5-6-9-12;/h3-9H2,1-2H3;1H/b11-10-; |
| InChIKey | DAPPOECCMDJFCP-GMFCBQQYSA-N |
| XLogP | 3.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide?
The IUPAC name of ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide (CID 45157809) is ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide.
What is the SMILES notation for ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide?
The canonical SMILES for ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide is CCC/N=C(\SCC)N1CCCC1.I.
What is the InChIKey of ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide?
The InChIKey is DAPPOECCMDJFCP-GMFCBQQYSA-N. The full InChI is InChI=1S/C10H20N2S.HI/c1-3-7-11-10(13-4-2)12-8-5-6-9-12;/h3-9H2,1-2H3;1H/b11-10-;.
What are the key properties of ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide?
ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide has a molecular weight of 328.26 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-propylpyrrolidine-1-carboximidothioate;hydroiodide is sourced from PubChem (CID 45157809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).