C4H7F2NO — CID 45158835
N-ethyl-2,2-difluoroacetamide (PubChem CID 45158835) has the molecular formula C4H7F2NO and a molecular weight of 123.10 g/mol. Its IUPAC name is N-ethyl-2,2-difluoroacetamide.
| Compound Name | N-ethyl-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 45158835 |
| Molecular Formula | C4H7F2NO |
| Molecular Weight | 123.10 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | N-ethyl-2,2-difluoroacetamide |
| SMILES | CCNC(=O)C(F)F |
| InChI | InChI=1S/C4H7F2NO/c1-2-7-4(8)3(5)6/h3H,2H2,1H3,(H,7,8) |
| InChIKey | NPCMGJIFTRTKIZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.10 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |