About (4,4-difluorocyclohexyl)methanamine;hydrochloride
(4,4-difluorocyclohexyl)methanamine;hydrochloride (PubChem CID 45158931) has the molecular formula C7H14ClF2N
and a molecular weight of 185.64 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl)methanamine;hydrochloride |
| PubChem CID | 45158931 |
| Molecular Formula | C7H14ClF2N |
| Molecular Weight | 185.64 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | (4,4-difluorocyclohexyl)methanamine;hydrochloride |
| SMILES | Cl.NCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H13F2N.ClH/c8-7(9)3-1-6(5-10)2-4-7;/h6H,1-5,10H2;1H |
| InChIKey | HNJQCPHETXMWSG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.64 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4,4-difluorocyclohexyl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl)methanamine;hydrochloride?
The IUPAC name of (4,4-difluorocyclohexyl)methanamine;hydrochloride (CID 45158931) is (4,4-difluorocyclohexyl)methanamine;hydrochloride.
What is the SMILES notation for (4,4-difluorocyclohexyl)methanamine;hydrochloride?
The canonical SMILES for (4,4-difluorocyclohexyl)methanamine;hydrochloride is Cl.NCC1CCC(F)(F)CC1.
What is the InChIKey of (4,4-difluorocyclohexyl)methanamine;hydrochloride?
The InChIKey is HNJQCPHETXMWSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2N.ClH/c8-7(9)3-1-6(5-10)2-4-7;/h6H,1-5,10H2;1H.
What are the key properties of (4,4-difluorocyclohexyl)methanamine;hydrochloride?
(4,4-difluorocyclohexyl)methanamine;hydrochloride has a molecular weight of 185.64 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl)methanamine;hydrochloride is sourced from PubChem (CID 45158931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).