C26H28N4O3 — CID 45160032
[5-(1,3-benzodioxol-5-ylmethylamino)-1-methyl-4,5,6,7-tetrahydroindazol-3-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 45160032) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is [5-(1,3-benzodioxol-5-ylmethylamino)-1-methyl-4,5,6,7-tetrahydroindazol-3-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | [5-(1,3-benzodioxol-5-ylmethylamino)-1-methyl-4,5,6,7-tetrahydroindazol-3-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 45160032 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | [5-(1,3-benzodioxol-5-ylmethylamino)-1-methyl-4,5,6,7-tetrahydroindazol-3-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | Cn1nc(C(=O)N2CCc3ccccc3C2)c2c1CCC(NCc1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C26H28N4O3/c1-29-22-8-7-20(27-14-17-6-9-23-24(12-17)33-16-32-23)13-21(22)25(28-29)26(31)30-11-10-18-4-2-3-5-19(18)15-30/h2-6,9,12,20,27H,7-8,10-11,13-16H2,1H3 |
| InChIKey | NZLZKUFKGDDHFX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |