C24H30N4O4 — CID 45160889
5-[(2,4-dimethoxyphenyl)methylamino]-N-(furan-2-ylmethyl)-N,1-dimethyl-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 45160889) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 5-[(2,4-dimethoxyphenyl)methylamino]-N-(furan-2-ylmethyl)-N,1-dimethyl-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 5-[(2,4-dimethoxyphenyl)methylamino]-N-(furan-2-ylmethyl)-N,1-dimethyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 45160889 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-[(2,4-dimethoxyphenyl)methylamino]-N-(furan-2-ylmethyl)-N,1-dimethyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | COc1ccc(CNC2CCc3c(c(C(=O)N(C)Cc4ccco4)nn3C)C2)c(OC)c1 |
| InChI | InChI=1S/C24H30N4O4/c1-27(15-19-6-5-11-32-19)24(29)23-20-12-17(8-10-21(20)28(2)26-23)25-14-16-7-9-18(30-3)13-22(16)31-4/h5-7,9,11,13,17,25H,8,10,12,14-15H2,1-4H3 |
| InChIKey | LLCKCCQGDRPLRC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |