About 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole
1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole (PubChem CID 4516281) has the molecular formula C22H18ClN3
and a molecular weight of 359.86 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole.
Molecular Properties
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
| PubChem CID | 4516281 |
| Molecular Formula | C22H18ClN3 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
| SMILES | Cc1ccc(Cl)cc1-n1nc(-c2cccc3ccccc23)c2c1NCC2 |
| InChI | InChI=1S/C22H18ClN3/c1-14-9-10-16(23)13-20(14)26-22-19(11-12-24-22)21(25-26)18-8-4-6-15-5-2-3-7-17(15)18/h2-10,13,24H,11-12H2,1H3 |
| InChIKey | RNMSSJOTOKPJDB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole?
The IUPAC name of 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole (CID 4516281) is 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole.
What is the SMILES notation for 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole?
The canonical SMILES for 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole is Cc1ccc(Cl)cc1-n1nc(-c2cccc3ccccc23)c2c1NCC2.
What is the InChIKey of 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole?
The InChIKey is RNMSSJOTOKPJDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18ClN3/c1-14-9-10-16(23)13-20(14)26-22-19(11-12-24-22)21(25-26)18-8-4-6-15-5-2-3-7-17(15)18/h2-10,13,24H,11-12H2,1H3.
What are the key properties of 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole?
1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole has a molecular weight of 359.86 g/mol, XLogP of 5.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-2-methylphenyl)-3-naphthalen-1-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole is sourced from PubChem (CID 4516281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).