C21H32N4O — CID 45164429
[5-(azepan-1-yl)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 45164429) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is [5-(azepan-1-yl)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-(azepan-1-yl)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 45164429 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | [5-(azepan-1-yl)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | C=CCn1nc(C(=O)N2CCCC2)c2c1CCC(N1CCCCCC1)C2 |
| InChI | InChI=1S/C21H32N4O/c1-2-11-25-19-10-9-17(23-12-5-3-4-6-13-23)16-18(19)20(22-25)21(26)24-14-7-8-15-24/h2,17H,1,3-16H2 |
| InChIKey | IQGXQSZLWXFGND-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|