C26H32N4O3 — CID 45164853
1-(2-methoxyethyl)-3-(pyridin-3-ylmethyl)-8-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 45164853) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-(pyridin-3-ylmethyl)-8-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-(2-methoxyethyl)-3-(pyridin-3-ylmethyl)-8-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 45164853 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-(2-methoxyethyl)-3-(pyridin-3-ylmethyl)-8-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCN1C(=O)N(Cc2cccnc2)C(=O)C12CCN(C1CCc3ccccc3C1)CC2 |
| InChI | InChI=1S/C26H32N4O3/c1-33-16-15-30-25(32)29(19-20-5-4-12-27-18-20)24(31)26(30)10-13-28(14-11-26)23-9-8-21-6-2-3-7-22(21)17-23/h2-7,12,18,23H,8-11,13-17,19H2,1H3 |
| InChIKey | OFAPYGMOXIPSRS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|