C20H26N2O3 — CID 45164965
4-but-2-ynoyl-1-(2-methylpropyl)-6-phenylmethoxy-1,4-diazepan-2-one (PubChem CID 45164965) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-but-2-ynoyl-1-(2-methylpropyl)-6-phenylmethoxy-1,4-diazepan-2-one.
| Compound Name | 4-but-2-ynoyl-1-(2-methylpropyl)-6-phenylmethoxy-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 45164965 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 4-but-2-ynoyl-1-(2-methylpropyl)-6-phenylmethoxy-1,4-diazepan-2-one |
| SMILES | CC#CC(=O)N1CC(=O)N(CC(C)C)CC(OCc2ccccc2)C1 |
| InChI | InChI=1S/C20H26N2O3/c1-4-8-19(23)22-13-18(25-15-17-9-6-5-7-10-17)12-21(11-16(2)3)20(24)14-22/h5-7,9-10,16,18H,11-15H2,1-3H3 |
| InChIKey | CVMHINHNGQZWMB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|