About 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide
1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide (PubChem CID 45165686) has the molecular formula C20H28N4O2
and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide |
| PubChem CID | 45165686 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide |
| SMILES | Cc1ccc2c(C)nc(N3CCCC(C(=O)NC(C)(C)CO)C3)nc2c1 |
| InChI | InChI=1S/C20H28N4O2/c1-13-7-8-16-14(2)21-19(22-17(16)10-13)24-9-5-6-15(11-24)18(26)23-20(3,4)12-25/h7-8,10,15,25H,5-6,9,11-12H2,1-4H3,(H,23,26) |
| InChIKey | MGICECMQQLRAGF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide?
The IUPAC name of 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide (CID 45165686) is 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide.
What is the SMILES notation for 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide?
The canonical SMILES for 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide is Cc1ccc2c(C)nc(N3CCCC(C(=O)NC(C)(C)CO)C3)nc2c1.
What is the InChIKey of 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide?
The InChIKey is MGICECMQQLRAGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O2/c1-13-7-8-16-14(2)21-19(22-17(16)10-13)24-9-5-6-15(11-24)18(26)23-20(3,4)12-25/h7-8,10,15,25H,5-6,9,11-12H2,1-4H3,(H,23,26).
What are the key properties of 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide?
1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide has a molecular weight of 356.47 g/mol, XLogP of 2.35, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,7-dimethylquinazolin-2-yl)-N-(1-hydroxy-2-methylpropan-2-yl)piperidine-3-carboxamide is sourced from PubChem (CID 45165686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).