C23H27N3O3S — CID 45165812
1-ethyl-3-(2-methylphenyl)-3-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 45165812) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 1-ethyl-3-(2-methylphenyl)-3-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-ethyl-3-(2-methylphenyl)-3-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 45165812 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1-ethyl-3-(2-methylphenyl)-3-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)CC(CC(=O)N2CCCCC2c2nccs2)(c2ccccc2C)C1=O |
| InChI | InChI=1S/C23H27N3O3S/c1-3-25-19(27)14-23(22(25)29,17-9-5-4-8-16(17)2)15-20(28)26-12-7-6-10-18(26)21-24-11-13-30-21/h4-5,8-9,11,13,18H,3,6-7,10,12,14-15H2,1-2H3 |
| InChIKey | ZJHWJUIAFONBMI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|