About 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine
4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine (PubChem CID 45166121) has the molecular formula C25H28FN3O2
and a molecular weight of 421.52 g/mol. Its IUPAC name is 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine.
Molecular Properties
| Compound Name | 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine |
| PubChem CID | 45166121 |
| Molecular Formula | C25H28FN3O2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine |
| SMILES | COc1cccc(CN2CCCC(c3nc(C)ncc3-c3ccc(F)cc3)C2)c1OC |
| InChI | InChI=1S/C25H28FN3O2/c1-17-27-14-22(18-9-11-21(26)12-10-18)24(28-17)19-7-5-13-29(15-19)16-20-6-4-8-23(30-2)25(20)31-3/h4,6,8-12,14,19H,5,7,13,15-16H2,1-3H3 |
| InChIKey | CMHYIGGSTOLLKE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine?
The IUPAC name of 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine (CID 45166121) is 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine.
What is the SMILES notation for 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine?
The canonical SMILES for 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine is COc1cccc(CN2CCCC(c3nc(C)ncc3-c3ccc(F)cc3)C2)c1OC.
What is the InChIKey of 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine?
The InChIKey is CMHYIGGSTOLLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28FN3O2/c1-17-27-14-22(18-9-11-21(26)12-10-18)24(28-17)19-7-5-13-29(15-19)16-20-6-4-8-23(30-2)25(20)31-3/h4,6,8-12,14,19H,5,7,13,15-16H2,1-3H3.
What are the key properties of 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine?
4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine has a molecular weight of 421.52 g/mol, XLogP of 4.99, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-3-yl]-5-(4-fluorophenyl)-2-methylpyrimidine is sourced from PubChem (CID 45166121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).