C24H21FN4O2 — CID 45166630
N-[(4-fluoro-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dimethyl-1H-indole-7-carboxamide (PubChem CID 45166630) has the molecular formula C24H21FN4O2 and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[(4-fluoro-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dimethyl-1H-indole-7-carboxamide.
| Compound Name | N-[(4-fluoro-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dimethyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 45166630 |
| Molecular Formula | C24H21FN4O2 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[(4-fluoro-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dimethyl-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)NCC3Cc4c(F)ccc(-c5ncccn5)c4O3)cccc2c1C |
| InChI | InChI=1S/C24H21FN4O2/c1-13-14(2)29-21-16(13)5-3-6-17(21)24(30)28-12-15-11-19-20(25)8-7-18(22(19)31-15)23-26-9-4-10-27-23/h3-10,15,29H,11-12H2,1-2H3,(H,28,30) |
| InChIKey | MBCQBDFZNDNEHF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|